C8H7ClF3N3S — CID 106595721
4-chloro-2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carbonitrile (PubChem CID 106595721) has the molecular formula C8H7ClF3N3S and a molecular weight of 269.68 g/mol. Its IUPAC name is 4-chloro-2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-chloro-2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 106595721 |
| Molecular Formula | C8H7ClF3N3S |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 4-chloro-2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1sc(NCCCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C8H7ClF3N3S/c9-6-5(4-13)16-7(15-6)14-3-1-2-8(10,11)12/h1-3H2,(H,14,15) |
| InChIKey | CBICKEKUUGWQPC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|