C11H15ClN4OS — CID 106596018
4-chloro-2-(2-piperidin-4-yloxyethylamino)-1,3-thiazole-5-carbonitrile (PubChem CID 106596018) has the molecular formula C11H15ClN4OS and a molecular weight of 286.79 g/mol. Its IUPAC name is 4-chloro-2-(2-piperidin-4-yloxyethylamino)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-chloro-2-(2-piperidin-4-yloxyethylamino)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 106596018 |
| Molecular Formula | C11H15ClN4OS |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-chloro-2-(2-piperidin-4-yloxyethylamino)-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1sc(NCCOC2CCNCC2)nc1Cl |
| InChI | InChI=1S/C11H15ClN4OS/c12-10-9(7-13)18-11(16-10)15-5-6-17-8-1-3-14-4-2-8/h8,14H,1-6H2,(H,15,16) |
| InChIKey | XLNBUGQATTZLET-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|