About [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane
[(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane (PubChem CID 10659619) has the molecular formula C15H31NOSi
and a molecular weight of 269.50 g/mol. Its IUPAC name is [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane |
| PubChem CID | 10659619 |
| Molecular Formula | C15H31NOSi |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane |
| SMILES | CC/C(=C/[C@H](C)[Si](C)(C)C)N1CCC[C@H]1COC |
| InChI | InChI=1S/C15H31NOSi/c1-7-14(11-13(2)18(4,5)6)16-10-8-9-15(16)12-17-3/h11,13,15H,7-10,12H2,1-6H3/b14-11-/t13-,15-/m0/s1 |
| InChIKey | UYRSDHRDEUEUEL-LANAQNJFSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane?
The IUPAC name of [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane (CID 10659619) is [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane.
What is the SMILES notation for [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane?
The canonical SMILES for [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane is CC/C(=C/[C@H](C)[Si](C)(C)C)N1CCC[C@H]1COC.
What is the InChIKey of [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane?
The InChIKey is UYRSDHRDEUEUEL-LANAQNJFSA-N. The full InChI is InChI=1S/C15H31NOSi/c1-7-14(11-13(2)18(4,5)6)16-10-8-9-15(16)12-17-3/h11,13,15H,7-10,12H2,1-6H3/b14-11-/t13-,15-/m0/s1.
What are the key properties of [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane?
[(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane has a molecular weight of 269.50 g/mol, XLogP of 4.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2S)-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]hex-3-en-2-yl]-trimethylsilane is sourced from PubChem (CID 10659619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).