About [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine
[2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 106596392) has the molecular formula C10H10F3N5O
and a molecular weight of 273.22 g/mol. Its IUPAC name is [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| PubChem CID | 106596392 |
| Molecular Formula | C10H10F3N5O |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | Cn1cnc(Oc2nc(C(F)(F)F)ccc2CN)n1 |
| InChI | InChI=1S/C10H10F3N5O/c1-18-5-15-9(17-18)19-8-6(4-14)2-3-7(16-8)10(11,12)13/h2-3,5H,4,14H2,1H3 |
| InChIKey | CQJXYXOIGDERKU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine?
The IUPAC name of [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine (CID 106596392) is [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine.
What is the SMILES notation for [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine?
The canonical SMILES for [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine is Cn1cnc(Oc2nc(C(F)(F)F)ccc2CN)n1.
What is the InChIKey of [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine?
The InChIKey is CQJXYXOIGDERKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N5O/c1-18-5-15-9(17-18)19-8-6(4-14)2-3-7(16-8)10(11,12)13/h2-3,5H,4,14H2,1H3.
What are the key properties of [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine?
[2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine has a molecular weight of 273.22 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)-3-pyridinyl]methanamine is sourced from PubChem (CID 106596392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).