C12H18O5Si — CID 10659676
(3aS,7aS)-4-methoxy-6-trimethylsilyloxy-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 10659676) has the molecular formula C12H18O5Si and a molecular weight of 270.36 g/mol. Its IUPAC name is (3aS,7aS)-4-methoxy-6-trimethylsilyloxy-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,7aS)-4-methoxy-6-trimethylsilyloxy-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 10659676 |
| Molecular Formula | C12H18O5Si |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3aS,7aS)-4-methoxy-6-trimethylsilyloxy-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | COC1C=C(O[Si](C)(C)C)C[C@@H]2C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C12H18O5Si/c1-15-9-6-7(17-18(2,3)4)5-8-10(9)12(14)16-11(8)13/h6,8-10H,5H2,1-4H3/t8-,9?,10-/m0/s1 |
| InChIKey | NSWHLWBPOOMWQS-SMILAEQMSA-N |
| XLogP | 1.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|