C15H26O4 — CID 10659678
(2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 10659678) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane.
| Compound Name | (2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 10659678 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3-dimethyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | C[C@H]1OC(C[C@@H]2CCC3(C2)O[C@H](C)[C@@H](C)O3)O[C@@H]1C |
| InChI | InChI=1S/C15H26O4/c1-9-10(2)17-14(16-9)7-13-5-6-15(8-13)18-11(3)12(4)19-15/h9-14H,5-8H2,1-4H3/t9-,10-,11-,12-,13+/m1/s1 |
| InChIKey | OCWQKIZBJZYELW-VEGXAWMVSA-N |
| XLogP | 2.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |