C12H14N6O2 — CID 106597215
N'-hydroxy-2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide (PubChem CID 106597215) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is N'-hydroxy-2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 106597215 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N'-hydroxy-2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide |
| SMILES | Cn1cnc(Oc2nc3c(cc2C(N)=NO)CCC3)n1 |
| InChI | InChI=1S/C12H14N6O2/c1-18-6-14-12(16-18)20-11-8(10(13)17-19)5-7-3-2-4-9(7)15-11/h5-6,19H,2-4H2,1H3,(H2,13,17) |
| InChIKey | YHJXASYLYKASOY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|