About 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide
2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 106597292) has the molecular formula C10H9F3N6O
and a molecular weight of 286.22 g/mol. Its IUPAC name is 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide |
| PubChem CID | 106597292 |
| Molecular Formula | C10H9F3N6O |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(F)(F)F)nc1Oc1ncn(C)n1 |
| InChI | InChI=1S/C10H9F3N6O/c1-19-4-16-9(18-19)20-8-5(7(14)15)2-3-6(17-8)10(11,12)13/h2-4H,1H3,(H3,14,15) |
| InChIKey | NYAKMBVSCYQWHC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide?
The IUPAC name of 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide (CID 106597292) is 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide.
What is the SMILES notation for 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide?
The canonical SMILES for 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide is [H]/N=C(\N)c1ccc(C(F)(F)F)nc1Oc1ncn(C)n1.
What is the InChIKey of 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide?
The InChIKey is NYAKMBVSCYQWHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N6O/c1-19-4-16-9(18-19)20-8-5(7(14)15)2-3-6(17-8)10(11,12)13/h2-4H,1H3,(H3,14,15).
What are the key properties of 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide?
2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide has a molecular weight of 286.22 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-1,2,4-triazol-3-yl)oxy]-6-(trifluoromethyl)pyridine-3-carboximidamide is sourced from PubChem (CID 106597292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).