C9H8Cl2N4O — CID 106597658
3-chloro-2-(chloromethyl)-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridine (PubChem CID 106597658) has the molecular formula C9H8Cl2N4O and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-chloro-2-(chloromethyl)-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridine.
| Compound Name | 3-chloro-2-(chloromethyl)-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridine |
|---|---|
| PubChem CID | 106597658 |
| Molecular Formula | C9H8Cl2N4O |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 3-chloro-2-(chloromethyl)-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridine |
| SMILES | Cn1cnc(Oc2ccc(Cl)c(CCl)n2)n1 |
| InChI | InChI=1S/C9H8Cl2N4O/c1-15-5-12-9(14-15)16-8-3-2-6(11)7(4-10)13-8/h2-3,5H,4H2,1H3 |
| InChIKey | KHNCHWIVIWAPBG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|