C11H15N3O2S2 — CID 106597902
3-[cyclobutyl(methyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 106597902) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[cyclobutyl(methyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 3-[cyclobutyl(methyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106597902 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[cyclobutyl(methyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CN(C1CCC1)S(=O)(=O)c1cccnc1C(N)=S |
| InChI | InChI=1S/C11H15N3O2S2/c1-14(8-4-2-5-8)18(15,16)9-6-3-7-13-10(9)11(12)17/h3,6-8H,2,4-5H2,1H3,(H2,12,17) |
| InChIKey | MEUJPWWNKCNNFB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|