About 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine
5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 10659823) has the molecular formula C8H8IN3
and a molecular weight of 273.08 g/mol. Its IUPAC name is 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 10659823 |
| Molecular Formula | C8H8IN3 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(C)c2c(I)c[nH]c2n1 |
| InChI | InChI=1S/C8H8IN3/c1-4-7-6(9)3-10-8(7)12-5(2)11-4/h3H,1-2H3,(H,10,11,12) |
| InChIKey | KYNZFTIXGQFOTH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (CID 10659823) is 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine is Cc1nc(C)c2c(I)c[nH]c2n1.
What is the InChIKey of 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is KYNZFTIXGQFOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8IN3/c1-4-7-6(9)3-10-8(7)12-5(2)11-4/h3H,1-2H3,(H,10,11,12).
What are the key properties of 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine?
5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 273.08 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 10659823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).