About methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate
methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate (PubChem CID 10659968) has the molecular formula C14H30O3Si
and a molecular weight of 274.48 g/mol. Its IUPAC name is methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate |
| PubChem CID | 10659968 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate |
| SMILES | COC(=O)[C@H](C)C[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-11(9-12(2)13(15)16-6)10-17-18(7,8)14(3,4)5/h11-12H,9-10H2,1-8H3/t11-,12+/m0/s1 |
| InChIKey | POAOTTUQBJXDQS-NWDGAFQWSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate?
The IUPAC name of methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate (CID 10659968) is methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate.
What is the SMILES notation for methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate?
The canonical SMILES for methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate is COC(=O)[C@H](C)C[C@H](C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate?
The InChIKey is POAOTTUQBJXDQS-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H30O3Si/c1-11(9-12(2)13(15)16-6)10-17-18(7,8)14(3,4)5/h11-12H,9-10H2,1-8H3/t11-,12+/m0/s1.
What are the key properties of methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate?
methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate has a molecular weight of 274.48 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanoate is sourced from PubChem (CID 10659968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).