C7H5NO4 — CID 1066
pyridine-2,3-dicarboxylic acid (PubChem CID 1066) has the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. Its IUPAC name is pyridine-2,3-dicarboxylic acid.
| Compound Name | pyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 1066 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | pyridine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccnc1C(=O)O |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | GJAWHXHKYYXBSV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |