C16H20O2S — CID 10660110
(1R,3R,4S,5R)-4,6,6-trimethyl-3-[(S)-phenylsulfinyl]bicyclo[3.1.1]heptan-2-one (PubChem CID 10660110) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is (1R,3R,4S,5R)-4,6,6-trimethyl-3-[(S)-phenylsulfinyl]bicyclo[3.1.1]heptan-2-one.
| Compound Name | (1R,3R,4S,5R)-4,6,6-trimethyl-3-[(S)-phenylsulfinyl]bicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 10660110 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1R,3R,4S,5R)-4,6,6-trimethyl-3-[(S)-phenylsulfinyl]bicyclo[3.1.1]heptan-2-one |
| SMILES | C[C@H]1[C@H]2C[C@@H](C(=O)[C@@H]1[S@](=O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C16H20O2S/c1-10-12-9-13(16(12,2)3)14(17)15(10)19(18)11-7-5-4-6-8-11/h4-8,10,12-13,15H,9H2,1-3H3/t10-,12+,13-,15+,19+/m0/s1 |
| InChIKey | JHNBECKRGKATDL-VUMLVGAVSA-N |
| XLogP | 3.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |