About methyl 11-phenylundecanoate
methyl 11-phenylundecanoate (PubChem CID 10660115) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is methyl 11-phenylundecanoate.
Molecular Properties
| Compound Name | methyl 11-phenylundecanoate |
| PubChem CID | 10660115 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | methyl 11-phenylundecanoate |
| SMILES | COC(=O)CCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C18H28O2/c1-20-18(19)16-12-7-5-3-2-4-6-9-13-17-14-10-8-11-15-17/h8,10-11,14-15H,2-7,9,12-13,16H2,1H3 |
| InChIKey | OEYUUCWCJJESQQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 11-phenylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 11-phenylundecanoate?
The IUPAC name of methyl 11-phenylundecanoate (CID 10660115) is methyl 11-phenylundecanoate.
What is the SMILES notation for methyl 11-phenylundecanoate?
The canonical SMILES for methyl 11-phenylundecanoate is COC(=O)CCCCCCCCCCc1ccccc1.
What is the InChIKey of methyl 11-phenylundecanoate?
The InChIKey is OEYUUCWCJJESQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-20-18(19)16-12-7-5-3-2-4-6-9-13-17-14-10-8-11-15-17/h8,10-11,14-15H,2-7,9,12-13,16H2,1H3.
What are the key properties of methyl 11-phenylundecanoate?
methyl 11-phenylundecanoate has a molecular weight of 276.42 g/mol, XLogP of 4.91, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 11-phenylundecanoate is sourced from PubChem (CID 10660115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).