About 2-bromo-9H-thioxanthene
2-bromo-9H-thioxanthene (PubChem CID 10660130) has the molecular formula C13H9BrS
and a molecular weight of 277.19 g/mol. Its IUPAC name is 2-bromo-9H-thioxanthene.
Molecular Properties
| Compound Name | 2-bromo-9H-thioxanthene |
| PubChem CID | 10660130 |
| Molecular Formula | C13H9BrS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 2-bromo-9H-thioxanthene |
| SMILES | Brc1ccc2c(c1)Cc1ccccc1S2 |
| InChI | InChI=1S/C13H9BrS/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)15-13/h1-6,8H,7H2 |
| InChIKey | YYNRXAVNKLETAN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9H-thioxanthene?
The IUPAC name of 2-bromo-9H-thioxanthene (CID 10660130) is 2-bromo-9H-thioxanthene.
What is the SMILES notation for 2-bromo-9H-thioxanthene?
The canonical SMILES for 2-bromo-9H-thioxanthene is Brc1ccc2c(c1)Cc1ccccc1S2.
What is the InChIKey of 2-bromo-9H-thioxanthene?
The InChIKey is YYNRXAVNKLETAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrS/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)15-13/h1-6,8H,7H2.
What are the key properties of 2-bromo-9H-thioxanthene?
2-bromo-9H-thioxanthene has a molecular weight of 277.19 g/mol, XLogP of 4.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9H-thioxanthene is sourced from PubChem (CID 10660130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).