C13H13FN4OS — CID 106601928
[2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 106601928) has the molecular formula C13H13FN4OS and a molecular weight of 292.34 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106601928 |
| Molecular Formula | C13H13FN4OS |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzoxathiin-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C2CSc3ccccc3O2)nc(NN)c1F |
| InChI | InChI=1S/C13H13FN4OS/c1-7-11(14)13(18-15)17-12(16-7)9-6-20-10-5-3-2-4-8(10)19-9/h2-5,9H,6,15H2,1H3,(H,16,17,18) |
| InChIKey | SMPWPGFHQVBNME-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|