About [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate
[3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate (PubChem CID 10660223) has the molecular formula C16H22O4
and a molecular weight of 278.35 g/mol. Its IUPAC name is [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate |
| PubChem CID | 10660223 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate |
| SMILES | CC(=O)OC1(C2=CCCCO2)C(=O)C(C(C)(C)C)=C1C |
| InChI | InChI=1S/C16H22O4/c1-10-13(15(3,4)5)14(18)16(10,20-11(2)17)12-8-6-7-9-19-12/h8H,6-7,9H2,1-5H3 |
| InChIKey | CKZBCDGJUCXQOO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate?
The IUPAC name of [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate (CID 10660223) is [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate.
What is the SMILES notation for [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate?
The canonical SMILES for [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate is CC(=O)OC1(C2=CCCCO2)C(=O)C(C(C)(C)C)=C1C.
What is the InChIKey of [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate?
The InChIKey is CKZBCDGJUCXQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-10-13(15(3,4)5)14(18)16(10,20-11(2)17)12-8-6-7-9-19-12/h8H,6-7,9H2,1-5H3.
What are the key properties of [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate?
[3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate has a molecular weight of 278.35 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-tert-butyl-1-(3,4-dihydro-2H-pyran-6-yl)-2-methyl-4-oxocyclobut-2-en-1-yl] acetate is sourced from PubChem (CID 10660223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).