C17H30OSi — CID 10660273
(E)-4-[(1S,5R)-5,6,6-trimethyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]but-3-en-2-one (PubChem CID 10660273) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is (E)-4-[(1S,5R)-5,6,6-trimethyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]but-3-en-2-one.
| Compound Name | (E)-4-[(1S,5R)-5,6,6-trimethyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 10660273 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (E)-4-[(1S,5R)-5,6,6-trimethyl-2-(trimethylsilylmethyl)cyclohex-2-en-1-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@H]1C(C[Si](C)(C)C)=CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C17H30OSi/c1-13-8-10-15(12-19(5,6)7)16(17(13,3)4)11-9-14(2)18/h9-11,13,16H,8,12H2,1-7H3/b11-9+/t13-,16-/m1/s1 |
| InChIKey | FJIVTOXENGBOKZ-DHBBHTRVSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|