C13H20BrClN2S — CID 106602849
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)propan-2-amine (PubChem CID 106602849) has the molecular formula C13H20BrClN2S and a molecular weight of 351.74 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)propan-2-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 106602849 |
| Molecular Formula | C13H20BrClN2S |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)propan-2-amine |
| SMILES | CC(C)N(Cc1cc(Br)c(Cl)s1)CC1CCCN1 |
| InChI | InChI=1S/C13H20BrClN2S/c1-9(2)17(7-10-4-3-5-16-10)8-11-6-12(14)13(15)18-11/h6,9-10,16H,3-5,7-8H2,1-2H3 |
| InChIKey | MSEYRHSIFGZGMW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |