About 2,6-dibromo-3,5-dimethylphenol
2,6-dibromo-3,5-dimethylphenol (PubChem CID 10660357) has the molecular formula C8H8Br2O
and a molecular weight of 279.96 g/mol. Its IUPAC name is 2,6-dibromo-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2,6-dibromo-3,5-dimethylphenol |
| PubChem CID | 10660357 |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.89 |
| IUPAC Name | 2,6-dibromo-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(Br)c(O)c1Br |
| InChI | InChI=1S/C8H8Br2O/c1-4-3-5(2)7(10)8(11)6(4)9/h3,11H,1-2H3 |
| InChIKey | XLQZZIWSAWDWJP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dibromo-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-3,5-dimethylphenol?
The IUPAC name of 2,6-dibromo-3,5-dimethylphenol (CID 10660357) is 2,6-dibromo-3,5-dimethylphenol.
What is the SMILES notation for 2,6-dibromo-3,5-dimethylphenol?
The canonical SMILES for 2,6-dibromo-3,5-dimethylphenol is Cc1cc(C)c(Br)c(O)c1Br.
What is the InChIKey of 2,6-dibromo-3,5-dimethylphenol?
The InChIKey is XLQZZIWSAWDWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br2O/c1-4-3-5(2)7(10)8(11)6(4)9/h3,11H,1-2H3.
What are the key properties of 2,6-dibromo-3,5-dimethylphenol?
2,6-dibromo-3,5-dimethylphenol has a molecular weight of 279.96 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-3,5-dimethylphenol is sourced from PubChem (CID 10660357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).