C16H24BrClN2 — CID 106605640
N-[(2-bromo-4-chlorophenyl)methyl]-2-methyl-N-(pyrrolidin-2-ylmethyl)propan-1-amine (PubChem CID 106605640) has the molecular formula C16H24BrClN2 and a molecular weight of 359.74 g/mol. Its IUPAC name is N-[(2-bromo-4-chlorophenyl)methyl]-2-methyl-N-(pyrrolidin-2-ylmethyl)propan-1-amine.
| Compound Name | N-[(2-bromo-4-chlorophenyl)methyl]-2-methyl-N-(pyrrolidin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 106605640 |
| Molecular Formula | C16H24BrClN2 |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[(2-bromo-4-chlorophenyl)methyl]-2-methyl-N-(pyrrolidin-2-ylmethyl)propan-1-amine |
| SMILES | CC(C)CN(Cc1ccc(Cl)cc1Br)CC1CCCN1 |
| InChI | InChI=1S/C16H24BrClN2/c1-12(2)9-20(11-15-4-3-7-19-15)10-13-5-6-14(18)8-16(13)17/h5-6,8,12,15,19H,3-4,7,9-11H2,1-2H3 |
| InChIKey | SSMFJPJIOQRUPL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |