C14H22O4Si — CID 10660569
[(4S,5S)-5-acetyloxy-7-trimethylsilylhept-1-en-6-yn-4-yl] acetate (PubChem CID 10660569) has the molecular formula C14H22O4Si and a molecular weight of 282.41 g/mol. Its IUPAC name is [(4S,5S)-5-acetyloxy-7-trimethylsilylhept-1-en-6-yn-4-yl] acetate.
| Compound Name | [(4S,5S)-5-acetyloxy-7-trimethylsilylhept-1-en-6-yn-4-yl] acetate |
|---|---|
| PubChem CID | 10660569 |
| Molecular Formula | C14H22O4Si |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [(4S,5S)-5-acetyloxy-7-trimethylsilylhept-1-en-6-yn-4-yl] acetate |
| SMILES | C=CC[C@H](OC(C)=O)[C@H](C#C[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C14H22O4Si/c1-7-8-13(17-11(2)15)14(18-12(3)16)9-10-19(4,5)6/h7,13-14H,1,8H2,2-6H3/t13-,14-/m0/s1 |
| InChIKey | STMWKDFOJZLHNG-KBPBESRZSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|