About N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide
N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide (PubChem CID 10660637) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide |
| PubChem CID | 10660637 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide |
| SMILES | Cc1c(C(=O)N=C(N)N)cc(S(C)(=O)=O)c(C)c1C |
| InChI | InChI=1S/C12H17N3O3S/c1-6-7(2)9(11(16)15-12(13)14)5-10(8(6)3)19(4,17)18/h5H,1-4H3,(H4,13,14,15,16) |
| InChIKey | IGRPGBCHFYIXFR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide?
The IUPAC name of N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide (CID 10660637) is N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide.
What is the SMILES notation for N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide?
The canonical SMILES for N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide is Cc1c(C(=O)N=C(N)N)cc(S(C)(=O)=O)c(C)c1C.
What is the InChIKey of N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide?
The InChIKey is IGRPGBCHFYIXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-6-7(2)9(11(16)15-12(13)14)5-10(8(6)3)19(4,17)18/h5H,1-4H3,(H4,13,14,15,16).
What are the key properties of N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide?
N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide has a molecular weight of 283.35 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-2,3,4-trimethyl-5-methylsulfonylbenzamide is sourced from PubChem (CID 10660637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).