C11H14BrClN2O2S — CID 106606906
3-bromo-4-chloro-N-[(3R)-piperidin-3-yl]benzenesulfonamide (PubChem CID 106606906) has the molecular formula C11H14BrClN2O2S and a molecular weight of 353.67 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[(3R)-piperidin-3-yl]benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-[(3R)-piperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 106606906 |
| Molecular Formula | C11H14BrClN2O2S |
| Molecular Weight | 353.67 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 3-bromo-4-chloro-N-[(3R)-piperidin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCNC1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H14BrClN2O2S/c12-10-6-9(3-4-11(10)13)18(16,17)15-8-2-1-5-14-7-8/h3-4,6,8,14-15H,1-2,5,7H2/t8-/m1/s1 |
| InChIKey | BFEKUBGUQNKECS-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |