C13H16ClN3O2S — CID 106607226
3-chloro-4-cyano-N-methyl-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide (PubChem CID 106607226) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-methyl-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-methyl-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106607226 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-chloro-4-cyano-N-methyl-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide |
| SMILES | CN(CC1CCCN1)S(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-17(9-11-3-2-6-16-11)20(18,19)12-5-4-10(8-15)13(14)7-12/h4-5,7,11,16H,2-3,6,9H2,1H3 |
| InChIKey | SKEXGIXMWSJMLJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |