C16H28O4 — CID 10660743
(2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 10660743) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane.
| Compound Name | (2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 10660743 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2R,3R,8S)-8-[[(4R,5R)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-2,3,8-trimethyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | C[C@H]1OC(C[C@]2(C)CCC3(C2)O[C@H](C)[C@@H](C)O3)O[C@@H]1C |
| InChI | InChI=1S/C16H28O4/c1-10-11(2)18-14(17-10)8-15(5)6-7-16(9-15)19-12(3)13(4)20-16/h10-14H,6-9H2,1-5H3/t10-,11-,12-,13-,15+/m1/s1 |
| InChIKey | VHFKGEIDQXFPDI-HVNMYJMUSA-N |
| XLogP | 3.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |