C13H15F3N2O2 — CID 106607911
2,4,5-trifluoro-3-hydroxy-N-methyl-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 106607911) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-methyl-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-methyl-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106607911 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-methyl-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | CN(CC1CCCN1)C(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H15F3N2O2/c1-18(6-7-3-2-4-17-7)13(20)8-5-9(14)11(16)12(19)10(8)15/h5,7,17,19H,2-4,6H2,1H3 |
| InChIKey | PHQJCQCMLDVMKL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|