C15H20FN3O — CID 106608284
N-(cyclopropylmethyl)-5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 106608284) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106608284 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-(cyclopropylmethyl)-5-fluoro-N-(pyrrolidin-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1cncc(F)c1)N(CC1CC1)CC1CCCN1 |
| InChI | InChI=1S/C15H20FN3O/c16-13-6-12(7-17-8-13)15(20)19(9-11-3-4-11)10-14-2-1-5-18-14/h6-8,11,14,18H,1-5,9-10H2 |
| InChIKey | ZIGGVPFDLPIXHX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |