C14H22O6 — CID 10660856
methyl 2-[(2R,4aR,6R,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 10660856) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is methyl 2-[(2R,4aR,6R,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2R,4aR,6R,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 10660856 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl 2-[(2R,4aR,6R,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@H]2O[C@@H](CC(=O)OC)CC[C@H]2O1 |
| InChI | InChI=1S/C14H22O6/c1-17-13(15)7-9-3-5-12-11(19-9)6-4-10(20-12)8-14(16)18-2/h9-12H,3-8H2,1-2H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | VITVTEZEVBVMKW-DDHJBXDOSA-N |
| XLogP | 1.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |