C16H34O2Si — CID 10660908
(3R,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-5-methylideneheptan-3-ol (PubChem CID 10660908) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is (3R,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-5-methylideneheptan-3-ol.
| Compound Name | (3R,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-5-methylideneheptan-3-ol |
|---|---|
| PubChem CID | 10660908 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (3R,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-5-methylideneheptan-3-ol |
| SMILES | C=C(C[C@@H](O)C(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-12(2)15(17)10-13(3)14(4)11-18-19(8,9)16(5,6)7/h12,14-15,17H,3,10-11H2,1-2,4-9H3/t14-,15-/m1/s1 |
| InChIKey | OKKOIVKTQWCHCM-HUUCEWRRSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|