C14H30O2Si2 — CID 10660910
2,5-dimethyl-1,6-bis(trimethylsilyl)hexane-1,6-dione (PubChem CID 10660910) has the molecular formula C14H30O2Si2 and a molecular weight of 286.56 g/mol. Its IUPAC name is 2,5-dimethyl-1,6-bis(trimethylsilyl)hexane-1,6-dione.
| Compound Name | 2,5-dimethyl-1,6-bis(trimethylsilyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 10660910 |
| Molecular Formula | C14H30O2Si2 |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2,5-dimethyl-1,6-bis(trimethylsilyl)hexane-1,6-dione |
| SMILES | CC(CCC(C)C(=O)[Si](C)(C)C)C(=O)[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si2/c1-11(13(15)17(3,4)5)9-10-12(2)14(16)18(6,7)8/h11-12H,9-10H2,1-8H3 |
| InChIKey | SHJPKVDWXRJRJH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|