C11H22F3N3O2S — CID 106609173
2-[[butyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]pyrrolidine (PubChem CID 106609173) has the molecular formula C11H22F3N3O2S and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-[[butyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]pyrrolidine.
| Compound Name | 2-[[butyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]pyrrolidine |
|---|---|
| PubChem CID | 106609173 |
| Molecular Formula | C11H22F3N3O2S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[[butyl(2,2,2-trifluoroethylsulfamoyl)amino]methyl]pyrrolidine |
| SMILES | CCCCN(CC1CCCN1)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H22F3N3O2S/c1-2-3-7-17(8-10-5-4-6-15-10)20(18,19)16-9-11(12,13)14/h10,15-16H,2-9H2,1H3 |
| InChIKey | XXJGUMPFXBMVFY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |