C15H23ClN2O2S — CID 106609514
4-chloro-N-(2-methylpropyl)-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide (PubChem CID 106609514) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 4-chloro-N-(2-methylpropyl)-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-methylpropyl)-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106609514 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-chloro-N-(2-methylpropyl)-N-(pyrrolidin-2-ylmethyl)benzenesulfonamide |
| SMILES | CC(C)CN(CC1CCCN1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClN2O2S/c1-12(2)10-18(11-14-4-3-9-17-14)21(19,20)15-7-5-13(16)6-8-15/h5-8,12,14,17H,3-4,9-11H2,1-2H3 |
| InChIKey | OPFMEAHUPPQDIY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |