C12H24N2O5S — CID 106609888
methyl 3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]propanoate (PubChem CID 106609888) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]propanoate.
| Compound Name | methyl 3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 106609888 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl 3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]propanoate |
| SMILES | COCCN(CC1CCCN1)S(=O)(=O)CCC(=O)OC |
| InChI | InChI=1S/C12H24N2O5S/c1-18-8-7-14(10-11-4-3-6-13-11)20(16,17)9-5-12(15)19-2/h11,13H,3-10H2,1-2H3 |
| InChIKey | XGVWHLITPSPOSJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |