C16H32O4 — CID 10661034
[(3R,4S,5R,6R,7R,8S)-5,7-dihydroxy-4,6,8-trimethyldecan-3-yl] propanoate (PubChem CID 10661034) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(3R,4S,5R,6R,7R,8S)-5,7-dihydroxy-4,6,8-trimethyldecan-3-yl] propanoate.
| Compound Name | [(3R,4S,5R,6R,7R,8S)-5,7-dihydroxy-4,6,8-trimethyldecan-3-yl] propanoate |
|---|---|
| PubChem CID | 10661034 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | [(3R,4S,5R,6R,7R,8S)-5,7-dihydroxy-4,6,8-trimethyldecan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H](CC)[C@@H](C)[C@H](O)[C@H](C)[C@H](O)[C@@H](C)CC |
| InChI | InChI=1S/C16H32O4/c1-7-10(4)15(18)12(6)16(19)11(5)13(8-2)20-14(17)9-3/h10-13,15-16,18-19H,7-9H2,1-6H3/t10-,11+,12+,13+,15+,16-/m0/s1 |
| InChIKey | KNNURWCRDMNZJS-UYWJUCARSA-N |
| XLogP | 2.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |