C17H34N2O — CID 106610480
3,5,5-trimethyl-N-propyl-N-(pyrrolidin-2-ylmethyl)hexanamide (PubChem CID 106610480) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 3,5,5-trimethyl-N-propyl-N-(pyrrolidin-2-ylmethyl)hexanamide.
| Compound Name | 3,5,5-trimethyl-N-propyl-N-(pyrrolidin-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 106610480 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 3,5,5-trimethyl-N-propyl-N-(pyrrolidin-2-ylmethyl)hexanamide |
| SMILES | CCCN(CC1CCCN1)C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H34N2O/c1-6-10-19(13-15-8-7-9-18-15)16(20)11-14(2)12-17(3,4)5/h14-15,18H,6-13H2,1-5H3 |
| InChIKey | SPBVPCBOSUCKSS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |