C13H26N2O3S — CID 106611302
N-(2-methylpropyl)-2-methylsulfonyl-N-(pyrrolidin-2-ylmethyl)propanamide (PubChem CID 106611302) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-methylsulfonyl-N-(pyrrolidin-2-ylmethyl)propanamide.
| Compound Name | N-(2-methylpropyl)-2-methylsulfonyl-N-(pyrrolidin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106611302 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(2-methylpropyl)-2-methylsulfonyl-N-(pyrrolidin-2-ylmethyl)propanamide |
| SMILES | CC(C)CN(CC1CCCN1)C(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O3S/c1-10(2)8-15(9-12-6-5-7-14-12)13(16)11(3)19(4,17)18/h10-12,14H,5-9H2,1-4H3 |
| InChIKey | TXFAHTFYERAADF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |