C15H20Cl2N2O2 — CID 106611526
2,6-dichloro-N-(2-methoxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 106611526) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-methoxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 2,6-dichloro-N-(2-methoxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106611526 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2,6-dichloro-N-(2-methoxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | COCCN(CC1CCCN1)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-21-9-8-19(10-11-4-3-7-18-11)15(20)14-12(16)5-2-6-13(14)17/h2,5-6,11,18H,3-4,7-10H2,1H3 |
| InChIKey | ADVJSFJNJOQPQU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |