C16H22Br2N2O — CID 106612246
2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 106612246) has the molecular formula C16H22Br2N2O and a molecular weight of 418.17 g/mol. Its IUPAC name is 2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106612246 |
| Molecular Formula | C16H22Br2N2O |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 2,5-dibromo-N-butyl-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | CCCCN(CC1CCCN1)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H22Br2N2O/c1-2-3-9-20(11-13-5-4-8-19-13)16(21)14-10-12(17)6-7-15(14)18/h6-7,10,13,19H,2-5,8-9,11H2,1H3 |
| InChIKey | BJWXYUUZHXCIMA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |