C15H21FN2O3 — CID 106613059
3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 106613059) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106613059 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-fluoro-N-(2-hydroxyethyl)-4-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCO)CC2CCCN2)cc1F |
| InChI | InChI=1S/C15H21FN2O3/c1-21-14-5-4-11(9-13(14)16)15(20)18(7-8-19)10-12-3-2-6-17-12/h4-5,9,12,17,19H,2-3,6-8,10H2,1H3 |
| InChIKey | JGLAXRWEOAEOBV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |