C13H25N3O2 — CID 106613333
3-(oxolan-3-yl)-1-propyl-1-(pyrrolidin-2-ylmethyl)urea (PubChem CID 106613333) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-1-propyl-1-(pyrrolidin-2-ylmethyl)urea.
| Compound Name | 3-(oxolan-3-yl)-1-propyl-1-(pyrrolidin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 106613333 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 3-(oxolan-3-yl)-1-propyl-1-(pyrrolidin-2-ylmethyl)urea |
| SMILES | CCCN(CC1CCCN1)C(=O)NC1CCOC1 |
| InChI | InChI=1S/C13H25N3O2/c1-2-7-16(9-11-4-3-6-14-11)13(17)15-12-5-8-18-10-12/h11-12,14H,2-10H2,1H3,(H,15,17) |
| InChIKey | IGTPVURNNKJATC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |