About 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene
1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene (PubChem CID 10661344) has the molecular formula C17H24O2S
and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene |
| PubChem CID | 10661344 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene |
| SMILES | C=CC(C)(CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O2S/c1-6-17(5,13-7-8-14(2)3)20(18,19)16-11-9-15(4)10-12-16/h6,8-12H,1,7,13H2,2-5H3 |
| InChIKey | JYAVTWXJEDLURR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene?
The IUPAC name of 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene (CID 10661344) is 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene.
What is the SMILES notation for 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene?
The canonical SMILES for 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene is C=CC(C)(CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene?
The InChIKey is JYAVTWXJEDLURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2S/c1-6-17(5,13-7-8-14(2)3)20(18,19)16-11-9-15(4)10-12-16/h6,8-12H,1,7,13H2,2-5H3.
What are the key properties of 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene?
1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene has a molecular weight of 292.44 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,7-dimethylocta-1,6-dien-3-ylsulfonyl)-4-methylbenzene is sourced from PubChem (CID 10661344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).