C15H28N4O2 — CID 106614582
5,5-dimethyl-3-[2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]ethyl]imidazolidine-2,4-dione (PubChem CID 106614582) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106614582 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 5,5-dimethyl-3-[2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)N(CCN1C(=O)NC(C)(C)C1=O)CC1CCCN1 |
| InChI | InChI=1S/C15H28N4O2/c1-11(2)18(10-12-6-5-7-16-12)8-9-19-13(20)15(3,4)17-14(19)21/h11-12,16H,5-10H2,1-4H3,(H,17,21) |
| InChIKey | ISISRJSFYCMLAO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|