C18H30O3 — CID 10661481
(2E,6E,10S)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienal (PubChem CID 10661481) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is (2E,6E,10S)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienal.
| Compound Name | (2E,6E,10S)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienal |
|---|---|
| PubChem CID | 10661481 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2E,6E,10S)-10-(1,3-dioxolan-2-yl)-3,7,11-trimethyldodeca-2,6-dienal |
| SMILES | C/C(=C\C=O)CC/C=C(\C)CC[C@@H](C(C)C)C1OCCO1 |
| InChI | InChI=1S/C18H30O3/c1-14(2)17(18-20-12-13-21-18)9-8-15(3)6-5-7-16(4)10-11-19/h6,10-11,14,17-18H,5,7-9,12-13H2,1-4H3/b15-6+,16-10+/t17-/m0/s1 |
| InChIKey | GOAUWZBDLFILDX-MRZNNCNYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|