C13H21ClN4 — CID 106615398
N-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)ethanamine (PubChem CID 106615398) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is N-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)ethanamine.
| Compound Name | N-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106615398 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-N-(pyrrolidin-2-ylmethyl)ethanamine |
| SMILES | CCN(Cc1nc(C)cc(Cl)n1)CC1CCCN1 |
| InChI | InChI=1S/C13H21ClN4/c1-3-18(8-11-5-4-6-15-11)9-13-16-10(2)7-12(14)17-13/h7,11,15H,3-6,8-9H2,1-2H3 |
| InChIKey | FYCOAGQDYRMHMS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |