C19H24N2O — CID 10661648
2-(anilinomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 10661648) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-(anilinomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-(anilinomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10661648 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-(anilinomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CNc1ccccc1)O2 |
| InChI | InChI=1S/C19H24N2O/c1-12-13(2)18-16(14(3)17(12)20)10-19(4,22-18)11-21-15-8-6-5-7-9-15/h5-9,21H,10-11,20H2,1-4H3 |
| InChIKey | RZYLPSJIOLKZCT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|