C17H31N3O — CID 106616738
2-[butyl(pyrrolidin-2-ylmethyl)amino]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 106616738) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-[butyl(pyrrolidin-2-ylmethyl)amino]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[butyl(pyrrolidin-2-ylmethyl)amino]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 106616738 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 2-[butyl(pyrrolidin-2-ylmethyl)amino]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN(CCCC)CC1CCCN1 |
| InChI | InChI=1S/C17H31N3O/c1-4-7-13-19(14-16-9-8-10-18-16)15-17(21)20(11-5-2)12-6-3/h5-6,16,18H,2-4,7-15H2,1H3 |
| InChIKey | ZVIVGSKBICBYKG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|