C12H24N4O3 — CID 106617540
N-carbamoyl-3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]propanamide (PubChem CID 106617540) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-carbamoyl-3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]propanamide.
| Compound Name | N-carbamoyl-3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 106617540 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | N-carbamoyl-3-[2-methoxyethyl(pyrrolidin-2-ylmethyl)amino]propanamide |
| SMILES | COCCN(CCC(=O)NC(N)=O)CC1CCCN1 |
| InChI | InChI=1S/C12H24N4O3/c1-19-8-7-16(9-10-3-2-5-14-10)6-4-11(17)15-12(13)18/h10,14H,2-9H2,1H3,(H3,13,15,17,18) |
| InChIKey | KMZOJNHITDOSQE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |