About piperazin-2-ylmethyl piperidine-1-carboxylate
piperazin-2-ylmethyl piperidine-1-carboxylate (PubChem CID 10661916) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is piperazin-2-ylmethyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | piperazin-2-ylmethyl piperidine-1-carboxylate |
| PubChem CID | 10661916 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | piperazin-2-ylmethyl piperidine-1-carboxylate |
| SMILES | O=C(OCC1CNCCN1)N1CCCCC1 |
| InChI | InChI=1S/C11H21N3O2/c15-11(14-6-2-1-3-7-14)16-9-10-8-12-4-5-13-10/h10,12-13H,1-9H2 |
| InChIKey | HEMYQLSQYZHWLT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-2-ylmethyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-2-ylmethyl piperidine-1-carboxylate?
The IUPAC name of piperazin-2-ylmethyl piperidine-1-carboxylate (CID 10661916) is piperazin-2-ylmethyl piperidine-1-carboxylate.
What is the SMILES notation for piperazin-2-ylmethyl piperidine-1-carboxylate?
The canonical SMILES for piperazin-2-ylmethyl piperidine-1-carboxylate is O=C(OCC1CNCCN1)N1CCCCC1.
What is the InChIKey of piperazin-2-ylmethyl piperidine-1-carboxylate?
The InChIKey is HEMYQLSQYZHWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c15-11(14-6-2-1-3-7-14)16-9-10-8-12-4-5-13-10/h10,12-13H,1-9H2.
What are the key properties of piperazin-2-ylmethyl piperidine-1-carboxylate?
piperazin-2-ylmethyl piperidine-1-carboxylate has a molecular weight of 227.31 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-2-ylmethyl piperidine-1-carboxylate is sourced from PubChem (CID 10661916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).